C7H9Cl2N3 — CID 174959611
1,3-dichlorobenzene;guanidine (PubChem CID 174959611) has the molecular formula C7H9Cl2N3 and a molecular weight of 206.08 g/mol. Its IUPAC name is 1,3-dichlorobenzene;guanidine.
| Compound Name | 1,3-dichlorobenzene;guanidine |
|---|---|
| PubChem CID | 174959611 |
| Molecular Formula | C7H9Cl2N3 |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 1,3-dichlorobenzene;guanidine |
| SMILES | Clc1cccc(Cl)c1.[H]N=C(N)N |
| InChI | InChI=1S/C6H4Cl2.CH5N3/c7-5-2-1-3-6(8)4-5;2-1(3)4/h1-4H;(H5,2,3,4) |
| InChIKey | HTWIVWJMBTXCMU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|