acetic acid;1,3-dichlorobenzene;hydrate

C8H10Cl2O3 — CID 118105432

IUPACacetic acid;1,3-dichlorobenzene;hydrate
SMILESCC(=O)O.Clc1cccc(Cl)c1.O
InChIInChI=1S/C6H4Cl2.C2H4O2.H2O/c7-5-2-1-3-6(8)4-5;1-2(3)4;/h1-4H;1H3,(H,3,4);1H2
InChIKeyPJTPLKDKPRELLS-UHFFFAOYSA-N
MW225.07 g/mol
LogP2.26
Rot. Bonds

About acetic acid;1,3-dichlorobenzene;hydrate

acetic acid;1,3-dichlorobenzene;hydrate (PubChem CID 118105432) has the molecular formula C8H10Cl2O3 and a molecular weight of 225.07 g/mol. Its IUPAC name is acetic acid;1,3-dichlorobenzene;hydrate.

Molecular Properties

Compound Nameacetic acid;1,3-dichlorobenzene;hydrate
PubChem CID118105432
Molecular FormulaC8H10Cl2O3
Molecular Weight225.07 g/mol
Exact Mass224.00
IUPAC Nameacetic acid;1,3-dichlorobenzene;hydrate
SMILESCC(=O)O.Clc1cccc(Cl)c1.O
InChIInChI=1S/C6H4Cl2.C2H4O2.H2O/c7-5-2-1-3-6(8)4-5;1-2(3)4;/h1-4H;1H3,(H,3,4);1H2
InChIKeyPJTPLKDKPRELLS-UHFFFAOYSA-N
XLogP2.26
TPSA68.80 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.07
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze acetic acid;1,3-dichlorobenzene;hydrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1,3-dichlorobenzene;hydrate?
The IUPAC name of acetic acid;1,3-dichlorobenzene;hydrate (CID 118105432) is acetic acid;1,3-dichlorobenzene;hydrate.
What is the SMILES notation for acetic acid;1,3-dichlorobenzene;hydrate?
The canonical SMILES for acetic acid;1,3-dichlorobenzene;hydrate is CC(=O)O.Clc1cccc(Cl)c1.O.
What is the InChIKey of acetic acid;1,3-dichlorobenzene;hydrate?
The InChIKey is PJTPLKDKPRELLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C2H4O2.H2O/c7-5-2-1-3-6(8)4-5;1-2(3)4;/h1-4H;1H3,(H,3,4);1H2.
What are the key properties of acetic acid;1,3-dichlorobenzene;hydrate?
acetic acid;1,3-dichlorobenzene;hydrate has a molecular weight of 225.07 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,3-dichlorobenzene;hydrate is sourced from PubChem (CID 118105432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).