C10H14Cl2FNO2 — CID 174957029
1,3-dichlorobenzene;2-fluoroacetic acid;N-methylmethanamine (PubChem CID 174957029) has the molecular formula C10H14Cl2FNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 1,3-dichlorobenzene;2-fluoroacetic acid;N-methylmethanamine.
| Compound Name | 1,3-dichlorobenzene;2-fluoroacetic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 174957029 |
| Molecular Formula | C10H14Cl2FNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1,3-dichlorobenzene;2-fluoroacetic acid;N-methylmethanamine |
| SMILES | CNC.Clc1cccc(Cl)c1.O=C(O)CF |
| InChI | InChI=1S/C6H4Cl2.C2H3FO2.C2H7N/c7-5-2-1-3-6(8)4-5;3-1-2(4)5;1-3-2/h1-4H;1H2,(H,4,5);3H,1-2H3 |
| InChIKey | QLPOSYRUFIMXNE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |