C11H14ClNO2 — CID 43753632
2-(3-chlorophenyl)-2-(methylamino)butanoic acid (PubChem CID 43753632) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(methylamino)butanoic acid.
| Compound Name | 2-(3-chlorophenyl)-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 43753632 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(methylamino)butanoic acid |
| SMILES | CCC(NC)(C(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO2/c1-3-11(13-2,10(14)15)8-5-4-6-9(12)7-8/h4-7,13H,3H2,1-2H3,(H,14,15) |
| InChIKey | OPYOUMZTFFXZBT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |