3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid

C13H17ClO3 — CID 62396288

IUPAC3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid
SMILESCCC(O)(c1cccc(Cl)c1)C(C)(C)C(=O)O
InChIInChI=1S/C13H17ClO3/c1-4-13(17,12(2,3)11(15)16)9-6-5-7-10(14)8-9/h5-8,17H,4H2,1-3H3,(H,15,16)
InChIKeyBQYGHIHXOPIVKI-UHFFFAOYSA-N
MW256.73 g/mol
LogP3.05
Rot. Bonds4

About 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid

3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid (PubChem CID 62396288) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid.

Molecular Properties

Compound Name3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid
PubChem CID62396288
Molecular FormulaC13H17ClO3
Molecular Weight256.73 g/mol
Exact Mass256.09
IUPAC Name3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid
SMILESCCC(O)(c1cccc(Cl)c1)C(C)(C)C(=O)O
InChIInChI=1S/C13H17ClO3/c1-4-13(17,12(2,3)11(15)16)9-6-5-7-10(14)8-9/h5-8,17H,4H2,1-3H3,(H,15,16)
InChIKeyBQYGHIHXOPIVKI-UHFFFAOYSA-N
XLogP3.05
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.73
LogP ≤ 53.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid?
The IUPAC name of 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid (CID 62396288) is 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid.
What is the SMILES notation for 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid?
The canonical SMILES for 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid is CCC(O)(c1cccc(Cl)c1)C(C)(C)C(=O)O.
What is the InChIKey of 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid?
The InChIKey is BQYGHIHXOPIVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO3/c1-4-13(17,12(2,3)11(15)16)9-6-5-7-10(14)8-9/h5-8,17H,4H2,1-3H3,(H,15,16).
What are the key properties of 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid?
3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid has a molecular weight of 256.73 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-3-hydroxy-2,2-dimethylpentanoic acid is sourced from PubChem (CID 62396288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).