About magnesium;1,3-dichlorobenzene;hydride
magnesium;1,3-dichlorobenzene;hydride (PubChem CID 173052292) has the molecular formula C6H6Cl2Mg
and a molecular weight of 173.33 g/mol. Its IUPAC name is magnesium;1,3-dichlorobenzene;hydride.
Molecular Properties
| Compound Name | magnesium;1,3-dichlorobenzene;hydride |
| PubChem CID | 173052292 |
| Molecular Formula | C6H6Cl2Mg |
| Molecular Weight | 173.33 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | magnesium;1,3-dichlorobenzene;hydride |
| SMILES | Clc1cccc(Cl)c1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C6H4Cl2.Mg.2H/c7-5-2-1-3-6(8)4-5;;;/h1-4H;;;/q;+2;2*-1 |
| InChIKey | NSATVRYYYXOUJC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;1,3-dichlorobenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,3-dichlorobenzene;hydride?
The IUPAC name of magnesium;1,3-dichlorobenzene;hydride (CID 173052292) is magnesium;1,3-dichlorobenzene;hydride.
What is the SMILES notation for magnesium;1,3-dichlorobenzene;hydride?
The canonical SMILES for magnesium;1,3-dichlorobenzene;hydride is Clc1cccc(Cl)c1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;1,3-dichlorobenzene;hydride?
The InChIKey is NSATVRYYYXOUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.Mg.2H/c7-5-2-1-3-6(8)4-5;;;/h1-4H;;;/q;+2;2*-1.
What are the key properties of magnesium;1,3-dichlorobenzene;hydride?
magnesium;1,3-dichlorobenzene;hydride has a molecular weight of 173.33 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,3-dichlorobenzene;hydride is sourced from PubChem (CID 173052292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).