About 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide
2-[(3-chlorophenyl)methyl]guanidine;hydroiodide (PubChem CID 167747614) has the molecular formula C8H11ClIN3
and a molecular weight of 311.55 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide |
| PubChem CID | 167747614 |
| Molecular Formula | C8H11ClIN3 |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H10ClN3.HI/c9-7-3-1-2-6(4-7)5-12-8(10)11;/h1-4H,5H2,(H4,10,11,12);1H |
| InChIKey | ZLXQZQPTHLZJBR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide?
The IUPAC name of 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide (CID 167747614) is 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide.
What is the SMILES notation for 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide?
The canonical SMILES for 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide is I.NC(N)=NCc1cccc(Cl)c1.
What is the InChIKey of 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide?
The InChIKey is ZLXQZQPTHLZJBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3.HI/c9-7-3-1-2-6(4-7)5-12-8(10)11;/h1-4H,5H2,(H4,10,11,12);1H.
What are the key properties of 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide?
2-[(3-chlorophenyl)methyl]guanidine;hydroiodide has a molecular weight of 311.55 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chlorophenyl)methyl]guanidine;hydroiodide is sourced from PubChem (CID 167747614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).