C14H11ClF2N2 — CID 20706455
N'-[(3-chlorophenyl)methyl]-3,4-difluorobenzenecarboximidamide (PubChem CID 20706455) has the molecular formula C14H11ClF2N2 and a molecular weight of 280.71 g/mol. Its IUPAC name is N'-[(3-chlorophenyl)methyl]-3,4-difluorobenzenecarboximidamide.
| Compound Name | N'-[(3-chlorophenyl)methyl]-3,4-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 20706455 |
| Molecular Formula | C14H11ClF2N2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N'-[(3-chlorophenyl)methyl]-3,4-difluorobenzenecarboximidamide |
| SMILES | N/C(=N\Cc1cccc(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF2N2/c15-11-3-1-2-9(6-11)8-19-14(18)10-4-5-12(16)13(17)7-10/h1-7H,8H2,(H2,18,19) |
| InChIKey | PFPXBMRRYDGFKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|