C32H28N4O — CID 169205876
N'-benzyl-3-[5-[3-(N'-benzylcarbamimidoyl)phenyl]furan-2-yl]benzenecarboximidamide (PubChem CID 169205876) has the molecular formula C32H28N4O and a molecular weight of 484.60 g/mol. Its IUPAC name is N'-benzyl-3-[5-[3-(N'-benzylcarbamimidoyl)phenyl]furan-2-yl]benzenecarboximidamide.
| Compound Name | N'-benzyl-3-[5-[3-(N'-benzylcarbamimidoyl)phenyl]furan-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 169205876 |
| Molecular Formula | C32H28N4O |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N'-benzyl-3-[5-[3-(N'-benzylcarbamimidoyl)phenyl]furan-2-yl]benzenecarboximidamide |
| SMILES | N/C(=N\Cc1ccccc1)c1cccc(-c2ccc(-c3cccc(/C(N)=N/Cc4ccccc4)c3)o2)c1 |
| InChI | InChI=1S/C32H28N4O/c33-31(35-21-23-9-3-1-4-10-23)27-15-7-13-25(19-27)29-17-18-30(37-29)26-14-8-16-28(20-26)32(34)36-22-24-11-5-2-6-12-24/h1-20H,21-22H2,(H2,33,35)(H2,34,36) |
| InChIKey | PSYWSOSESGTSCJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|