C49H33N3 — CID 164766385
N'-benzyl-3-[4-[12-(3-isocyanophenyl)chrysen-6-yl]naphthalen-1-yl]benzenecarboximidamide (PubChem CID 164766385) has the molecular formula C49H33N3 and a molecular weight of 663.82 g/mol. Its IUPAC name is N'-benzyl-3-[4-[12-(3-isocyanophenyl)chrysen-6-yl]naphthalen-1-yl]benzenecarboximidamide.
| Compound Name | N'-benzyl-3-[4-[12-(3-isocyanophenyl)chrysen-6-yl]naphthalen-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 164766385 |
| Molecular Formula | C49H33N3 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | N'-benzyl-3-[4-[12-(3-isocyanophenyl)chrysen-6-yl]naphthalen-1-yl]benzenecarboximidamide |
| SMILES | [C-]#[N+]c1cccc(-c2cc3c4ccccc4c(-c4ccc(-c5cccc(/C(N)=N/Cc6ccccc6)c5)c5ccccc45)cc3c3ccccc23)c1 |
| InChI | InChI=1S/C49H33N3/c1-51-36-18-12-16-34(28-36)45-29-47-43-24-10-9-23-42(43)46(30-48(47)41-22-8-7-21-40(41)45)44-26-25-37(38-19-5-6-20-39(38)44)33-15-11-17-35(27-33)49(50)52-31-32-13-3-2-4-14-32/h2-30H,31H2,(H2,50,52) |
| InChIKey | HIWMMSKWBFKDJB-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|