C55H33N5 — CID 164766127
6-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-12-(3-isocyanophenyl)naphtho[2,1-f]quinoline (PubChem CID 164766127) has the molecular formula C55H33N5 and a molecular weight of 763.90 g/mol. Its IUPAC name is 6-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-12-(3-isocyanophenyl)naphtho[2,1-f]quinoline.
| Compound Name | 6-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-12-(3-isocyanophenyl)naphtho[2,1-f]quinoline |
|---|---|
| PubChem CID | 164766127 |
| Molecular Formula | C55H33N5 |
| Molecular Weight | 763.90 g/mol |
| Exact Mass | 763.27 |
| IUPAC Name | 6-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-12-(3-isocyanophenyl)naphtho[2,1-f]quinoline |
| SMILES | [C-]#[N+]c1cccc(-c2cc3c4ccccc4c(-c4ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c5ccccc45)cc3c3cccnc23)c1 |
| InChI | InChI=1S/C55H33N5/c1-56-40-22-13-20-38(32-40)48-33-50-45-26-11-10-25-44(45)49(34-51(50)47-27-14-30-57-52(47)48)46-29-28-41(42-23-8-9-24-43(42)46)37-19-12-21-39(31-37)55-59-53(35-15-4-2-5-16-35)58-54(60-55)36-17-6-3-7-18-36/h2-34H |
| InChIKey | KIGUPIPKTJZDOM-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.90 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|