C58H37N5 — CID 164766190
12-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-isocyanonaphthalen-1-yl)naphtho[2,1-f]quinoline (PubChem CID 164766190) has the molecular formula C58H37N5 and a molecular weight of 803.97 g/mol. Its IUPAC name is 12-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-isocyanonaphthalen-1-yl)naphtho[2,1-f]quinoline.
| Compound Name | 12-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-isocyanonaphthalen-1-yl)naphtho[2,1-f]quinoline |
|---|---|
| PubChem CID | 164766190 |
| Molecular Formula | C58H37N5 |
| Molecular Weight | 803.97 g/mol |
| Exact Mass | 803.30 |
| IUPAC Name | 12-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-isocyanonaphthalen-1-yl)naphtho[2,1-f]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cc3c4cccnc4c(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)n5)c4)cc3c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C58H37N5/c1-58(2)51-25-12-11-22-43(51)44-27-26-38(32-52(44)58)57-62-55(35-15-5-4-6-16-35)61-56(63-57)37-18-13-17-36(31-37)47-33-49-41-21-8-7-20-40(41)48(34-50(49)46-24-14-30-60-54(46)47)42-28-29-53(59-3)45-23-10-9-19-39(42)45/h4-34H,1-2H3 |
| InChIKey | JJGABAGIIFQWQX-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.97 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|