C52H35N5 — CID 171421936
8-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinoline (PubChem CID 171421936) has the molecular formula C52H35N5 and a molecular weight of 729.89 g/mol. Its IUPAC name is 8-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinoline.
| Compound Name | 8-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinoline |
|---|---|
| PubChem CID | 171421936 |
| Molecular Formula | C52H35N5 |
| Molecular Weight | 729.89 g/mol |
| Exact Mass | 729.29 |
| IUPAC Name | 8-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinoline |
| SMILES | [C-]#[N+]c1cccc2c1-c1ccc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc(-c4cccc5cccnc45)c3)cc1C2(C)C |
| InChI | InChI=1S/C52H35N5/c1-52(2)44-20-11-21-46(53-3)47(44)43-27-26-38(32-45(43)52)39-29-40(42-19-10-17-35-18-12-28-54-48(35)42)31-41(30-39)51-56-49(36-15-8-5-9-16-36)55-50(57-51)37-24-22-34(23-25-37)33-13-6-4-7-14-33/h4-32H,1-2H3 |
| InChIKey | OCXLZYORLYETPG-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.89 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|