C59H36N4 — CID 162775713
2-[3-(5-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 162775713) has the molecular formula C59H36N4 and a molecular weight of 800.97 g/mol. Its IUPAC name is 2-[3-(5-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(5-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162775713 |
| Molecular Formula | C59H36N4 |
| Molecular Weight | 800.97 g/mol |
| Exact Mass | 800.29 |
| IUPAC Name | 2-[3-(5-isocyano-9,9'-spirobi[fluorene]-2-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc2c1-c1ccc(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)cc1C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C59H36N4/c1-60-54-25-13-24-52-55(54)49-35-34-45(37-53(49)59(52)50-22-10-8-20-47(50)48-21-9-11-23-51(48)59)44-18-12-19-46(36-44)58-62-56(42-30-26-40(27-31-42)38-14-4-2-5-15-38)61-57(63-58)43-32-28-41(29-33-43)39-16-6-3-7-17-39/h2-37H |
| InChIKey | UHYLNFULWWVGCF-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.97 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|