C43H30N4 — CID 162775840
2-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 162775840) has the molecular formula C43H30N4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162775840 |
| Molecular Formula | C43H30N4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 2-[3-(5-isocyano-9,9-dimethylfluoren-2-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc2c1-c1ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)cc1C2(C)C |
| InChI | InChI=1S/C43H30N4/c1-43(2)36-18-11-19-38(44-3)39(36)35-25-24-33(27-37(35)43)32-16-10-17-34(26-32)42-46-40(30-14-8-5-9-15-30)45-41(47-42)31-22-20-29(21-23-31)28-12-6-4-7-13-28/h4-27H,1-2H3 |
| InChIKey | CWAYZQKJSNIHFB-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|