C45H30N4 — CID 162775838
2-[4-(5-isocyano-9,9-dimethylfluoren-3-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 162775838) has the molecular formula C45H30N4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 2-[4-(5-isocyano-9,9-dimethylfluoren-3-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[4-(5-isocyano-9,9-dimethylfluoren-3-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 162775838 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 2-[4-(5-isocyano-9,9-dimethylfluoren-3-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc2c1-c1cc(-c3ccc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)cc3)ccc1C2(C)C |
| InChI | InChI=1S/C45H30N4/c1-45(2)38-24-23-34(27-37(38)41-39(45)13-8-14-40(41)46-3)30-15-19-31(20-16-30)42-47-43(35-21-17-28-9-4-6-11-32(28)25-35)49-44(48-42)36-22-18-29-10-5-7-12-33(29)26-36/h4-27H,1-2H3 |
| InChIKey | KWNUISGFCCTCGX-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|