C47H30N6 — CID 171421769
7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-quinolin-7-ylphenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 171421769) has the molecular formula C47H30N6 and a molecular weight of 678.80 g/mol. Its IUPAC name is 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-quinolin-7-ylphenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-quinolin-7-ylphenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 171421769 |
| Molecular Formula | C47H30N6 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-quinolin-7-ylphenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc2c1-c1ccc(-c3cc(-c4ccc5cccnc5c4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc1C2(C)C |
| InChI | InChI=1S/C47H30N6/c1-47(2)39-26-33(18-19-38(39)43-40(47)21-29(28-48)22-42(43)49-3)35-23-36(34-17-16-30-15-10-20-50-41(30)27-34)25-37(24-35)46-52-44(31-11-6-4-7-12-31)51-45(53-46)32-13-8-5-9-14-32/h4-27H,1-2H3 |
| InChIKey | MURRAVNONDEYNG-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|