C60H39N7 — CID 171421863
7-[3-(3,5-dipyridin-3-ylphenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 171421863) has the molecular formula C60H39N7 and a molecular weight of 858.02 g/mol. Its IUPAC name is 7-[3-(3,5-dipyridin-3-ylphenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[3-(3,5-dipyridin-3-ylphenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 171421863 |
| Molecular Formula | C60H39N7 |
| Molecular Weight | 858.02 g/mol |
| Exact Mass | 857.33 |
| IUPAC Name | 7-[3-(3,5-dipyridin-3-ylphenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-isocyano-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc2c1-c1ccc(-c3cc(-c4cc(-c5cccnc5)cc(-c5cccnc5)c4)cc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)cc1C2(C)C |
| InChI | InChI=1S/C60H39N7/c1-60(2)53-34-43(22-23-52(53)56-54(60)26-38(35-61)27-55(56)62-3)46-28-50(49-30-47(44-16-10-24-63-36-44)29-48(31-49)45-17-11-25-64-37-45)33-51(32-46)59-66-57(41-14-8-5-9-15-41)65-58(67-59)42-20-18-40(19-21-42)39-12-6-4-7-13-39/h4-34,36-37H,1-2H3 |
| InChIKey | MUNBBZXLPQTKBX-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 92.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.02 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|