C56H32N6O — CID 164766277
6-[3-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-12-(4-isocyanophenyl)quinolino[6,5-f]quinoline (PubChem CID 164766277) has the molecular formula C56H32N6O and a molecular weight of 804.91 g/mol. Its IUPAC name is 6-[3-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-12-(4-isocyanophenyl)quinolino[6,5-f]quinoline.
| Compound Name | 6-[3-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-12-(4-isocyanophenyl)quinolino[6,5-f]quinoline |
|---|---|
| PubChem CID | 164766277 |
| Molecular Formula | C56H32N6O |
| Molecular Weight | 804.91 g/mol |
| Exact Mass | 804.26 |
| IUPAC Name | 6-[3-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-12-(4-isocyanophenyl)quinolino[6,5-f]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cc3c4cccnc4c(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc8c(c7)oc7ccccc78)n6)c5)c4)cc3c3cccnc23)cc1 |
| InChI | InChI=1S/C56H32N6O/c1-57-41-24-21-34(22-25-41)46-32-48-45-19-10-28-59-53(45)47(33-49(48)44-18-9-27-58-52(44)46)38-15-7-13-36(29-38)37-14-8-16-39(30-37)55-60-54(35-11-3-2-4-12-35)61-56(62-55)40-23-26-43-42-17-5-6-20-50(42)63-51(43)31-40/h2-33H |
| InChIKey | WGWKOLQEKMJAMG-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 81.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.91 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|