C57H33N5O — CID 167057213
4-[4-[6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]naphtho[2,1-f]quinolin-12-yl]phenyl]benzonitrile (PubChem CID 167057213) has the molecular formula C57H33N5O and a molecular weight of 803.93 g/mol. Its IUPAC name is 4-[4-[6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]naphtho[2,1-f]quinolin-12-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]naphtho[2,1-f]quinolin-12-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 167057213 |
| Molecular Formula | C57H33N5O |
| Molecular Weight | 803.93 g/mol |
| Exact Mass | 803.27 |
| IUPAC Name | 4-[4-[6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]naphtho[2,1-f]quinolin-12-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3cc4c5ccccc5c(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc8c(c7)oc7ccccc78)n6)c5)cc4c4cccnc34)cc2)cc1 |
| InChI | InChI=1S/C57H33N5O/c58-34-35-19-21-36(22-20-35)37-23-25-38(26-24-37)49-33-50-44-15-5-4-14-43(44)48(32-51(50)47-17-9-29-59-54(47)49)40-12-8-13-41(30-40)56-60-55(39-10-2-1-3-11-39)61-57(62-56)42-27-28-46-45-16-6-7-18-52(45)63-53(46)31-42/h1-33H |
| InChIKey | NKLAVKPHTLGFTC-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 88.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.93 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|