C51H29N5O — CID 164766312
6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-isocyanophenyl)naphtho[2,1-f]quinoline (PubChem CID 164766312) has the molecular formula C51H29N5O and a molecular weight of 727.83 g/mol. Its IUPAC name is 6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-isocyanophenyl)naphtho[2,1-f]quinoline.
| Compound Name | 6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-isocyanophenyl)naphtho[2,1-f]quinoline |
|---|---|
| PubChem CID | 164766312 |
| Molecular Formula | C51H29N5O |
| Molecular Weight | 727.83 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | 6-[3-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-isocyanophenyl)naphtho[2,1-f]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cc3c4ccccc4c(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7c(c6)oc6ccccc67)n5)c4)cc3c3cccnc23)cc1 |
| InChI | InChI=1S/C51H29N5O/c1-52-36-23-20-31(21-24-36)43-30-44-38-16-6-5-15-37(38)42(29-45(44)41-18-10-26-53-48(41)43)33-13-9-14-34(27-33)50-54-49(32-11-3-2-4-12-32)55-51(56-50)35-22-25-40-39-17-7-8-19-46(39)57-47(40)28-35/h2-30H |
| InChIKey | WARMDHZDMAMKOR-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.83 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|