C58H45N3O — CID 153340652
N'-benzylbenzenecarboximidamide;N-[[3-[3-(4,6,8-triphenyldibenzofuran-1-yl)phenyl]phenyl]methyl]methanimine (PubChem CID 153340652) has the molecular formula C58H45N3O and a molecular weight of 800.02 g/mol. Its IUPAC name is N'-benzylbenzenecarboximidamide;N-[[3-[3-(4,6,8-triphenyldibenzofuran-1-yl)phenyl]phenyl]methyl]methanimine.
| Compound Name | N'-benzylbenzenecarboximidamide;N-[[3-[3-(4,6,8-triphenyldibenzofuran-1-yl)phenyl]phenyl]methyl]methanimine |
|---|---|
| PubChem CID | 153340652 |
| Molecular Formula | C58H45N3O |
| Molecular Weight | 800.02 g/mol |
| Exact Mass | 799.36 |
| IUPAC Name | N'-benzylbenzenecarboximidamide;N-[[3-[3-(4,6,8-triphenyldibenzofuran-1-yl)phenyl]phenyl]methyl]methanimine |
| SMILES | C=NCc1cccc(-c2cccc(-c3ccc(-c4ccccc4)c4oc5c(-c6ccccc6)cc(-c6ccccc6)cc5c34)c2)c1.N/C(=N\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H31NO.C14H14N2/c1-45-29-30-13-11-20-34(25-30)35-21-12-22-36(26-35)38-23-24-39(32-16-7-3-8-17-32)44-42(38)41-28-37(31-14-5-2-6-15-31)27-40(43(41)46-44)33-18-9-4-10-19-33;15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h2-28H,1,29H2;1-10H,11H2,(H2,15,16) |
| InChIKey | QKEBSDSRGDYTDB-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.02 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|