C45H35N3 — CID 171052336
N-[amino(phenyl)methylidene]-4-(2,5-diphenylphenyl)-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide (PubChem CID 171052336) has the molecular formula C45H35N3 and a molecular weight of 617.80 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-4-(2,5-diphenylphenyl)-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-4-(2,5-diphenylphenyl)-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 171052336 |
| Molecular Formula | C45H35N3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | N-[amino(phenyl)methylidene]-4-(2,5-diphenylphenyl)-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(=N\Cc1ccc(-c2ccccc2)cc1)c1ccc(-c2cc(-c3ccccc3)ccc2-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H35N3/c46-44(39-19-11-4-12-20-39)48-45(47-32-33-21-23-36(24-22-33)34-13-5-1-6-14-34)40-27-25-38(26-28-40)43-31-41(35-15-7-2-8-16-35)29-30-42(43)37-17-9-3-10-18-37/h1-31H,32H2,(H2,46,47,48) |
| InChIKey | WGLKFMDRFLVLMX-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|