C34H29N3 — CID 144645775
N'-[C-(4-methylphenyl)-N-[(3-phenylphenyl)methyl]carbonimidoyl]-3-phenylbenzenecarboximidamide (PubChem CID 144645775) has the molecular formula C34H29N3 and a molecular weight of 479.63 g/mol. Its IUPAC name is N'-[C-(4-methylphenyl)-N-[(3-phenylphenyl)methyl]carbonimidoyl]-3-phenylbenzenecarboximidamide.
| Compound Name | N'-[C-(4-methylphenyl)-N-[(3-phenylphenyl)methyl]carbonimidoyl]-3-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144645775 |
| Molecular Formula | C34H29N3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N'-[C-(4-methylphenyl)-N-[(3-phenylphenyl)methyl]carbonimidoyl]-3-phenylbenzenecarboximidamide |
| SMILES | Cc1ccc(C(/N=C(\N)c2cccc(-c3ccccc3)c2)=N\Cc2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H29N3/c1-25-18-20-29(21-19-25)34(36-24-26-10-8-15-30(22-26)27-11-4-2-5-12-27)37-33(35)32-17-9-16-31(23-32)28-13-6-3-7-14-28/h2-23H,24H2,1H3,(H2,35,36,37) |
| InChIKey | UMXZVQYEOFVOSZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|