C55H46N6O — CID 174266484
N'-[N-benzyl-C-[4-[3-[N'-(N-benzyl-C-phenylcarbonimidoyl)carbamimidoyl]phenyl]naphthalen-2-yl]carbonimidoyl]-9,9-dimethylxanthene-3-carboximidamide (PubChem CID 174266484) has the molecular formula C55H46N6O and a molecular weight of 807.01 g/mol. Its IUPAC name is N'-[N-benzyl-C-[4-[3-[N'-(N-benzyl-C-phenylcarbonimidoyl)carbamimidoyl]phenyl]naphthalen-2-yl]carbonimidoyl]-9,9-dimethylxanthene-3-carboximidamide.
| Compound Name | N'-[N-benzyl-C-[4-[3-[N'-(N-benzyl-C-phenylcarbonimidoyl)carbamimidoyl]phenyl]naphthalen-2-yl]carbonimidoyl]-9,9-dimethylxanthene-3-carboximidamide |
|---|---|
| PubChem CID | 174266484 |
| Molecular Formula | C55H46N6O |
| Molecular Weight | 807.01 g/mol |
| Exact Mass | 806.37 |
| IUPAC Name | N'-[N-benzyl-C-[4-[3-[N'-(N-benzyl-C-phenylcarbonimidoyl)carbamimidoyl]phenyl]naphthalen-2-yl]carbonimidoyl]-9,9-dimethylxanthene-3-carboximidamide |
| SMILES | CC1(C)c2ccccc2Oc2cc(/C(N)=N/C(=N/Cc3ccccc3)c3cc(-c4cccc(/C(N)=N/C(=N/Cc5ccccc5)c5ccccc5)c4)c4ccccc4c3)ccc21 |
| InChI | InChI=1S/C55H46N6O/c1-55(2)47-27-14-15-28-49(47)62-50-34-43(29-30-48(50)55)52(57)61-54(59-36-38-19-8-4-9-20-38)44-32-40-23-12-13-26-45(40)46(33-44)41-24-16-25-42(31-41)51(56)60-53(39-21-10-5-11-22-39)58-35-37-17-6-3-7-18-37/h3-34H,35-36H2,1-2H3,(H2,56,58,60)(H2,57,59,61) |
| InChIKey | CJAOZACDWQUQLQ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.01 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|