C48H35N3O3 — CID 142561233
N'-[N-benzyl-C-(4-dibenzofuran-4-ylphenyl)carbonimidoyl]-8,8-dimethylindeno[1,2-a]oxanthrene-1-carboximidamide (PubChem CID 142561233) has the molecular formula C48H35N3O3 and a molecular weight of 701.83 g/mol. Its IUPAC name is N'-[N-benzyl-C-(4-dibenzofuran-4-ylphenyl)carbonimidoyl]-8,8-dimethylindeno[1,2-a]oxanthrene-1-carboximidamide.
| Compound Name | N'-[N-benzyl-C-(4-dibenzofuran-4-ylphenyl)carbonimidoyl]-8,8-dimethylindeno[1,2-a]oxanthrene-1-carboximidamide |
|---|---|
| PubChem CID | 142561233 |
| Molecular Formula | C48H35N3O3 |
| Molecular Weight | 701.83 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | N'-[N-benzyl-C-(4-dibenzofuran-4-ylphenyl)carbonimidoyl]-8,8-dimethylindeno[1,2-a]oxanthrene-1-carboximidamide |
| SMILES | CC1(C)c2ccccc2-c2c1ccc1c2Oc2c(cccc2/C(N)=N/C(=N/Cc2ccccc2)c2ccc(-c3cccc4c3oc3ccccc34)cc2)O1 |
| InChI | InChI=1S/C48H35N3O3/c1-48(2)37-19-8-6-15-35(37)42-38(48)26-27-41-45(42)54-44-36(18-11-21-40(44)52-41)46(49)51-47(50-28-29-12-4-3-5-13-29)31-24-22-30(23-25-31)32-16-10-17-34-33-14-7-9-20-39(33)53-43(32)34/h3-27H,28H2,1-2H3,(H2,49,50,51) |
| InChIKey | DIYQJSWLIATQJQ-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.83 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|