C42H35N3 — CID 145237270
N'-[N-benzyl-C-[3-(3-phenylphenyl)phenyl]carbonimidoyl]-9,9-dimethylfluorene-4-carboximidamide (PubChem CID 145237270) has the molecular formula C42H35N3 and a molecular weight of 581.76 g/mol. Its IUPAC name is N'-[N-benzyl-C-[3-(3-phenylphenyl)phenyl]carbonimidoyl]-9,9-dimethylfluorene-4-carboximidamide.
| Compound Name | N'-[N-benzyl-C-[3-(3-phenylphenyl)phenyl]carbonimidoyl]-9,9-dimethylfluorene-4-carboximidamide |
|---|---|
| PubChem CID | 145237270 |
| Molecular Formula | C42H35N3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | N'-[N-benzyl-C-[3-(3-phenylphenyl)phenyl]carbonimidoyl]-9,9-dimethylfluorene-4-carboximidamide |
| SMILES | CC1(C)c2ccccc2-c2c(/C(N)=N/C(=N/Cc3ccccc3)c3cccc(-c4cccc(-c5ccccc5)c4)c3)cccc21 |
| InChI | InChI=1S/C42H35N3/c1-42(2)37-24-10-9-22-35(37)39-36(23-13-25-38(39)42)40(43)45-41(44-28-29-14-5-3-6-15-29)34-21-12-20-33(27-34)32-19-11-18-31(26-32)30-16-7-4-8-17-30/h3-27H,28H2,1-2H3,(H2,43,44,45) |
| InChIKey | STDUIALNDIQQEM-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|