C35H29N3 — CID 142293920
N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-3-[3-(3-methylphenyl)phenyl]benzenecarboximidamide (PubChem CID 142293920) has the molecular formula C35H29N3 and a molecular weight of 491.64 g/mol. Its IUPAC name is N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-3-[3-(3-methylphenyl)phenyl]benzenecarboximidamide.
| Compound Name | N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-3-[3-(3-methylphenyl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142293920 |
| Molecular Formula | C35H29N3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-3-[3-(3-methylphenyl)phenyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1ccccc1)c1cccc(-c2cccc(-c3cccc(C)c3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C35H29N3/c1-26-12-9-17-29(22-26)30-18-10-19-31(23-30)32-20-11-21-33(24-32)35(37-25-27-13-5-3-6-14-27)38-34(36-2)28-15-7-4-8-16-28/h3-24H,2,25H2,1H3/b37-35-,38-34- |
| InChIKey | KNTMCAGAWXTSGM-FWWPQTSNSA-N |
| XLogP | 8.42 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|