C19H23N3 — CID 144831026
N'-(N-benzyl-C-methylcarbonimidoyl)-N-methylidenebenzenecarboximidamide;ethane (PubChem CID 144831026) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N'-(N-benzyl-C-methylcarbonimidoyl)-N-methylidenebenzenecarboximidamide;ethane.
| Compound Name | N'-(N-benzyl-C-methylcarbonimidoyl)-N-methylidenebenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 144831026 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N'-(N-benzyl-C-methylcarbonimidoyl)-N-methylidenebenzenecarboximidamide;ethane |
| SMILES | C=N/C(=N\C(C)=N\Cc1ccccc1)c1ccccc1.CC |
| InChI | InChI=1S/C17H17N3.C2H6/c1-14(19-13-15-9-5-3-6-10-15)20-17(18-2)16-11-7-4-8-12-16;1-2/h3-12H,2,13H2,1H3;1-2H3/b19-14+,20-17-; |
| InChIKey | KPXNQWDTDGDGMY-VUPSIUHUSA-N |
| XLogP | 4.78 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|