C29H31N3 — CID 145291848
N-benzylmethanimine;ethane;N-methylidene-N'-(naphthalen-1-ylmethyl)benzenecarboximidamide (PubChem CID 145291848) has the molecular formula C29H31N3 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-benzylmethanimine;ethane;N-methylidene-N'-(naphthalen-1-ylmethyl)benzenecarboximidamide.
| Compound Name | N-benzylmethanimine;ethane;N-methylidene-N'-(naphthalen-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 145291848 |
| Molecular Formula | C29H31N3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-benzylmethanimine;ethane;N-methylidene-N'-(naphthalen-1-ylmethyl)benzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1cccc2ccccc12)c1ccccc1.C=NCc1ccccc1.CC |
| InChI | InChI=1S/C19H16N2.C8H9N.C2H6/c1-20-19(16-9-3-2-4-10-16)21-14-17-12-7-11-15-8-5-6-13-18(15)17;1-9-7-8-5-3-2-4-6-8;1-2/h2-13H,1,14H2;2-6H,1,7H2;1-2H3/b21-19-;; |
| InChIKey | FZHWKAFEMRPJII-KSTMOPHVSA-N |
| XLogP | 7.40 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|