C24H21N3 — CID 145105527
N'-benzyl-N-methylidene-3-(3-methylindol-1-yl)benzenecarboximidamide (PubChem CID 145105527) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N'-benzyl-N-methylidene-3-(3-methylindol-1-yl)benzenecarboximidamide.
| Compound Name | N'-benzyl-N-methylidene-3-(3-methylindol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 145105527 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N'-benzyl-N-methylidene-3-(3-methylindol-1-yl)benzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1ccccc1)c1cccc(-n2cc(C)c3ccccc32)c1 |
| InChI | InChI=1S/C24H21N3/c1-18-17-27(23-14-7-6-13-22(18)23)21-12-8-11-20(15-21)24(25-2)26-16-19-9-4-3-5-10-19/h3-15,17H,2,16H2,1H3/b26-24- |
| InChIKey | JNEUBBRHIHAHOY-LCUIJRPUSA-N |
| XLogP | 5.59 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|