About N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane
N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane (PubChem CID 142505018) has the molecular formula C22H19ClN2O
and a molecular weight of 362.86 g/mol. Its IUPAC name is N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane.
Molecular Properties
| Compound Name | N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane |
| PubChem CID | 142505018 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane |
| SMILES | C=N/C(=N\Cc1ccccc1)c1ccc2oc3ccccc3c2c1.CCl |
| InChI | InChI=1S/C21H16N2O.CH3Cl/c1-22-21(23-14-15-7-3-2-4-8-15)16-11-12-20-18(13-16)17-9-5-6-10-19(17)24-20;1-2/h2-13H,1,14H2;1H3/b23-21-; |
| InChIKey | MZICMQHVJRPDLZ-VZXGSGAOSA-N |
| XLogP | 6.09 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane?
The IUPAC name of N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane (CID 142505018) is N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane.
What is the SMILES notation for N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane?
The canonical SMILES for N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane is C=N/C(=N\Cc1ccccc1)c1ccc2oc3ccccc3c2c1.CCl.
What is the InChIKey of N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane?
The InChIKey is MZICMQHVJRPDLZ-VZXGSGAOSA-N. The full InChI is InChI=1S/C21H16N2O.CH3Cl/c1-22-21(23-14-15-7-3-2-4-8-15)16-11-12-20-18(13-16)17-9-5-6-10-19(17)24-20;1-2/h2-13H,1,14H2;1H3/b23-21-;.
What are the key properties of N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane?
N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane has a molecular weight of 362.86 g/mol, XLogP of 6.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-methylidenedibenzofuran-2-carboximidamide;chloromethane is sourced from PubChem (CID 142505018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).