C40H27N3O2 — CID 170423493
N'-(N-benzyl-C-phenylcarbonimidoyl)-3-dibenzofuran-3-yl-N-methylidenedibenzofuran-1-carboximidamide (PubChem CID 170423493) has the molecular formula C40H27N3O2 and a molecular weight of 581.68 g/mol. Its IUPAC name is N'-(N-benzyl-C-phenylcarbonimidoyl)-3-dibenzofuran-3-yl-N-methylidenedibenzofuran-1-carboximidamide.
| Compound Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-dibenzofuran-3-yl-N-methylidenedibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 170423493 |
| Molecular Formula | C40H27N3O2 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-dibenzofuran-3-yl-N-methylidenedibenzofuran-1-carboximidamide |
| SMILES | C=N/C(=N\C(=N\Cc1ccccc1)c1ccccc1)c1cc(-c2ccc3c(c2)oc2ccccc23)cc2oc3ccccc3c12 |
| InChI | InChI=1S/C40H27N3O2/c1-41-40(43-39(27-14-6-3-7-15-27)42-25-26-12-4-2-5-13-26)33-22-29(24-37-38(33)32-17-9-11-19-35(32)45-37)28-20-21-31-30-16-8-10-18-34(30)44-36(31)23-28/h2-24H,1,25H2/b42-39+,43-40- |
| InChIKey | QYYROYXPWWJLRN-USQQWFJWSA-N |
| XLogP | 10.25 |
| TPSA | 63.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|