C50H39N3 — CID 170019754
N'-(N-benzyl-C-phenylcarbonimidoyl)-3-ethyl-N-methylidene-2-naphthalen-2-yl-5-(4-naphthalen-2-ylphenyl)benzenecarboximidamide (PubChem CID 170019754) has the molecular formula C50H39N3 and a molecular weight of 681.88 g/mol. Its IUPAC name is N'-(N-benzyl-C-phenylcarbonimidoyl)-3-ethyl-N-methylidene-2-naphthalen-2-yl-5-(4-naphthalen-2-ylphenyl)benzenecarboximidamide.
| Compound Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-ethyl-N-methylidene-2-naphthalen-2-yl-5-(4-naphthalen-2-ylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 170019754 |
| Molecular Formula | C50H39N3 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-ethyl-N-methylidene-2-naphthalen-2-yl-5-(4-naphthalen-2-ylphenyl)benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N\Cc1ccccc1)c1ccccc1)c1cc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc(CC)c1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H39N3/c1-3-36-30-46(40-24-22-39(23-25-40)44-28-26-37-16-10-12-20-42(37)31-44)33-47(48(36)45-29-27-38-17-11-13-21-43(38)32-45)50(51-2)53-49(41-18-8-5-9-19-41)52-34-35-14-6-4-7-15-35/h4-33H,2-3,34H2,1H3/b52-49+,53-50- |
| InChIKey | QYCHVOVEADKREC-ZMNMLNOLSA-N |
| XLogP | 12.65 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|