C46H36N4 — CID 142425047
N-benzylmethanimine;N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide (PubChem CID 142425047) has the molecular formula C46H36N4 and a molecular weight of 644.82 g/mol. Its IUPAC name is N-benzylmethanimine;N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N-benzylmethanimine;N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 142425047 |
| Molecular Formula | C46H36N4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | N-benzylmethanimine;N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1ccc(-c2cc3ccccc3cc2-c2ccc(-c3cccc(C#N)c3)cc2)cc1)c1ccccc1.C=NCc1ccccc1 |
| InChI | InChI=1S/C38H27N3.C8H9N/c1-40-38(32-9-3-2-4-10-32)41-26-27-14-16-30(17-15-27)36-23-34-11-5-6-12-35(34)24-37(36)31-20-18-29(19-21-31)33-13-7-8-28(22-33)25-39;1-9-7-8-5-3-2-4-6-8/h2-24H,1,26H2;2-6H,1,7H2/b41-38-; |
| InChIKey | IOUNHAHJWSFFPF-FGSADGKMSA-N |
| XLogP | 11.25 |
| TPSA | 60.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|