C38H27N3 — CID 142425048
N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide (PubChem CID 142425048) has the molecular formula C38H27N3 and a molecular weight of 525.66 g/mol. Its IUPAC name is N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 142425048 |
| Molecular Formula | C38H27N3 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | N'-[[4-[3-[4-(3-cyanophenyl)phenyl]naphthalen-2-yl]phenyl]methyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1ccc(-c2cc3ccccc3cc2-c2ccc(-c3cccc(C#N)c3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H27N3/c1-40-38(32-9-3-2-4-10-32)41-26-27-14-16-30(17-15-27)36-23-34-11-5-6-12-35(34)24-37(36)31-20-18-29(19-21-31)33-13-7-8-28(22-33)25-39/h2-24H,1,26H2/b41-38- |
| InChIKey | YFTZRMVRINBRNL-GJARRJKISA-N |
| XLogP | 9.36 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|