C47H35N3 — CID 138642968
N-methylidene-4-phenyl-N'-[C-phenyl-N-[[3-(9-phenylfluoren-9-yl)phenyl]methyl]carbonimidoyl]benzenecarboximidamide (PubChem CID 138642968) has the molecular formula C47H35N3 and a molecular weight of 641.82 g/mol. Its IUPAC name is N-methylidene-4-phenyl-N'-[C-phenyl-N-[[3-(9-phenylfluoren-9-yl)phenyl]methyl]carbonimidoyl]benzenecarboximidamide.
| Compound Name | N-methylidene-4-phenyl-N'-[C-phenyl-N-[[3-(9-phenylfluoren-9-yl)phenyl]methyl]carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 138642968 |
| Molecular Formula | C47H35N3 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | N-methylidene-4-phenyl-N'-[C-phenyl-N-[[3-(9-phenylfluoren-9-yl)phenyl]methyl]carbonimidoyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1cccc(C2(c3ccccc3)c3ccccc3-c3ccccc32)c1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C47H35N3/c1-48-45(38-30-28-36(29-31-38)35-17-5-2-6-18-35)50-46(37-19-7-3-8-20-37)49-33-34-16-15-23-40(32-34)47(39-21-9-4-10-22-39)43-26-13-11-24-41(43)42-25-12-14-27-44(42)47/h2-32H,1,33H2/b49-46-,50-45- |
| InChIKey | CCGVHUJPWAADIF-TZJVSMDNSA-N |
| XLogP | 10.81 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|