C43H34N4 — CID 142519466
N'-[N-[[3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]methyl]-C-phenylcarbonimidoyl]-N-methylidenebenzenecarboximidamide (PubChem CID 142519466) has the molecular formula C43H34N4 and a molecular weight of 606.77 g/mol. Its IUPAC name is N'-[N-[[3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]methyl]-C-phenylcarbonimidoyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[N-[[3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]methyl]-C-phenylcarbonimidoyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 142519466 |
| Molecular Formula | C43H34N4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | N'-[N-[[3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]methyl]-C-phenylcarbonimidoyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1cccc(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H34N4/c1-43(2)37-23-12-10-21-33(37)35-26-36-34-22-11-13-24-39(34)47(40(36)27-38(35)43)32-20-14-15-29(25-32)28-45-42(31-18-8-5-9-19-31)46-41(44-3)30-16-6-4-7-17-30/h4-27H,3,28H2,1-2H3/b45-42-,46-41- |
| InChIKey | CLAYXVCNSLHSNQ-GTASVPGUSA-N |
| XLogP | 10.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|