C36H30N4 — CID 171812843
N-[amino(phenyl)methylidene]-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-N'-methylbenzenecarboximidamide (PubChem CID 171812843) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-N'-methylbenzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 171812843 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[amino(phenyl)methylidene]-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/N=C(\N)c1ccccc1)c1cccc(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C36H30N4/c1-36(2)30-18-9-7-16-26(30)28-21-29-27-17-8-10-19-32(27)40(33(29)22-31(28)36)25-15-11-14-24(20-25)35(38-3)39-34(37)23-12-5-4-6-13-23/h4-22H,1-3H3,(H2,37,38,39) |
| InChIKey | FAVXOIYEXUZIKQ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|