C34H25N3O — CID 146395700
N'-benzyl-4-dibenzofuran-3-yl-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide (PubChem CID 146395700) has the molecular formula C34H25N3O and a molecular weight of 491.59 g/mol. Its IUPAC name is N'-benzyl-4-dibenzofuran-3-yl-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide.
| Compound Name | N'-benzyl-4-dibenzofuran-3-yl-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 146395700 |
| Molecular Formula | C34H25N3O |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N'-benzyl-4-dibenzofuran-3-yl-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1ccccc1)c1ccc(-c2ccc3c(c2)oc2ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H25N3O/c1-35-33(26-12-6-3-7-13-26)37-34(36-23-24-10-4-2-5-11-24)27-18-16-25(17-19-27)28-20-21-30-29-14-8-9-15-31(29)38-32(30)22-28/h2-22H,1,23H2/b36-34-,37-33- |
| InChIKey | KSRBMWYIKMOXFV-XJSANLPLSA-N |
| XLogP | 8.35 |
| TPSA | 50.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|