C44H29N3O — CID 170229475
N'-(N-benzyl-C-phenylcarbonimidoyl)-7-fluoranthen-3-yl-N-methylidenedibenzofuran-1-carboximidamide (PubChem CID 170229475) has the molecular formula C44H29N3O and a molecular weight of 615.74 g/mol. Its IUPAC name is N'-(N-benzyl-C-phenylcarbonimidoyl)-7-fluoranthen-3-yl-N-methylidenedibenzofuran-1-carboximidamide.
| Compound Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-7-fluoranthen-3-yl-N-methylidenedibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 170229475 |
| Molecular Formula | C44H29N3O |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-7-fluoranthen-3-yl-N-methylidenedibenzofuran-1-carboximidamide |
| SMILES | C=N/C(=N/C(=N/Cc1ccccc1)c1ccccc1)c1cccc2oc3cc(-c4ccc5c6c(cccc46)-c4ccccc4-5)ccc3c12 |
| InChI | InChI=1S/C44H29N3O/c1-45-44(47-43(29-14-6-3-7-15-29)46-27-28-12-4-2-5-13-28)38-20-11-21-39-42(38)37-23-22-30(26-40(37)48-39)31-24-25-36-33-17-9-8-16-32(33)35-19-10-18-34(31)41(35)36/h2-26H,1,27H2/b46-43+,47-44+ |
| InChIKey | LKTOLXPDPQINLZ-DJXFSNMPSA-N |
| XLogP | 11.15 |
| TPSA | 50.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|