C52H36N4O — CID 155002394
N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-8-[3-(3-phenylcarbazol-9-yl)phenyl]dibenzofuran-3-carboximidamide (PubChem CID 155002394) has the molecular formula C52H36N4O and a molecular weight of 732.89 g/mol. Its IUPAC name is N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-8-[3-(3-phenylcarbazol-9-yl)phenyl]dibenzofuran-3-carboximidamide.
| Compound Name | N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-8-[3-(3-phenylcarbazol-9-yl)phenyl]dibenzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 155002394 |
| Molecular Formula | C52H36N4O |
| Molecular Weight | 732.89 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | N'-benzyl-N-[(methylideneamino)-phenylmethylidene]-8-[3-(3-phenylcarbazol-9-yl)phenyl]dibenzofuran-3-carboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1ccccc1)c1ccc2c(c1)oc1ccc(-c3cccc(-n4c5ccccc5c5cc(-c6ccccc6)ccc54)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C52H36N4O/c1-53-51(37-18-9-4-10-19-37)55-52(54-34-35-14-5-2-6-15-35)41-24-27-44-46-32-40(26-29-49(46)57-50(44)33-41)38-20-13-21-42(30-38)56-47-23-12-11-22-43(47)45-31-39(25-28-48(45)56)36-16-7-3-8-17-36/h2-33H,1,34H2/b54-52-,55-51- |
| InChIKey | AHHDPIDSFNYJNH-URHOZWSBSA-N |
| XLogP | 13.11 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.89 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|