C51H36N4O — CID 170137005
N-[amino(phenyl)methylidene]-N'-benzyl-4-(3-dibenzofuran-3-ylcarbazol-9-yl)-3-phenylbenzenecarboximidamide (PubChem CID 170137005) has the molecular formula C51H36N4O and a molecular weight of 720.88 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-benzyl-4-(3-dibenzofuran-3-ylcarbazol-9-yl)-3-phenylbenzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-benzyl-4-(3-dibenzofuran-3-ylcarbazol-9-yl)-3-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170137005 |
| Molecular Formula | C51H36N4O |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-benzyl-4-(3-dibenzofuran-3-ylcarbazol-9-yl)-3-phenylbenzenecarboximidamide |
| SMILES | N/C(=N\C(=N\Cc1ccccc1)c1ccc(-n2c3ccccc3c3cc(-c4ccc5c(c4)oc4ccccc45)ccc32)c(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C51H36N4O/c52-50(36-18-8-3-9-19-36)54-51(53-33-34-14-4-1-5-15-34)39-26-29-46(43(31-39)35-16-6-2-7-17-35)55-45-22-12-10-20-40(45)44-30-37(25-28-47(44)55)38-24-27-42-41-21-11-13-23-48(41)56-49(42)32-38/h1-32H,33H2,(H2,52,53,54) |
| InChIKey | IYYLGAQARUEJRO-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|