C41H34N4 — CID 155203954
N-[amino(phenyl)methylidene]-N'-benzyl-4-[4-(3,6-dimethylcarbazol-9-yl)phenyl]benzenecarboximidamide (PubChem CID 155203954) has the molecular formula C41H34N4 and a molecular weight of 582.75 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-benzyl-4-[4-(3,6-dimethylcarbazol-9-yl)phenyl]benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-benzyl-4-[4-(3,6-dimethylcarbazol-9-yl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 155203954 |
| Molecular Formula | C41H34N4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-benzyl-4-[4-(3,6-dimethylcarbazol-9-yl)phenyl]benzenecarboximidamide |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2ccc(C(/N=C(\N)c3ccccc3)=N\Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H34N4/c1-28-13-23-38-36(25-28)37-26-29(2)14-24-39(37)45(38)35-21-19-32(20-22-35)31-15-17-34(18-16-31)41(43-27-30-9-5-3-6-10-30)44-40(42)33-11-7-4-8-12-33/h3-26H,27H2,1-2H3,(H2,42,43,44) |
| InChIKey | FPLGFCICMKCJFX-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|