C34H27N3O — CID 162363127
N-[amino-(4-phenylphenyl)methylidene]-N'-(dibenzofuran-3-ylmethyl)-4-methylbenzenecarboximidamide (PubChem CID 162363127) has the molecular formula C34H27N3O and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[amino-(4-phenylphenyl)methylidene]-N'-(dibenzofuran-3-ylmethyl)-4-methylbenzenecarboximidamide.
| Compound Name | N-[amino-(4-phenylphenyl)methylidene]-N'-(dibenzofuran-3-ylmethyl)-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 162363127 |
| Molecular Formula | C34H27N3O |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[amino-(4-phenylphenyl)methylidene]-N'-(dibenzofuran-3-ylmethyl)-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(C(/N=C(\N)c2ccc(-c3ccccc3)cc2)=N/Cc2ccc3c(c2)oc2ccccc23)cc1 |
| InChI | InChI=1S/C34H27N3O/c1-23-11-14-28(15-12-23)34(37-33(35)27-18-16-26(17-19-27)25-7-3-2-4-8-25)36-22-24-13-20-30-29-9-5-6-10-31(29)38-32(30)21-24/h2-21H,22H2,1H3,(H2,35,36,37) |
| InChIKey | YYGYFXNKIDBCOI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|