C47H39N3O — CID 176798493
N'-[C-phenyl-N-[(7,7,8,8-tetramethylpicen-2-yl)methyl]carbonimidoyl]dibenzofuran-3-carboximidamide (PubChem CID 176798493) has the molecular formula C47H39N3O and a molecular weight of 661.85 g/mol. Its IUPAC name is N'-[C-phenyl-N-[(7,7,8,8-tetramethylpicen-2-yl)methyl]carbonimidoyl]dibenzofuran-3-carboximidamide.
| Compound Name | N'-[C-phenyl-N-[(7,7,8,8-tetramethylpicen-2-yl)methyl]carbonimidoyl]dibenzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 176798493 |
| Molecular Formula | C47H39N3O |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | N'-[C-phenyl-N-[(7,7,8,8-tetramethylpicen-2-yl)methyl]carbonimidoyl]dibenzofuran-3-carboximidamide |
| SMILES | CC1(C)c2ccccc2-c2ccc3c(ccc4ccc(C/N=C(\N=C(/N)c5ccc6c(c5)oc5ccccc56)c5ccccc5)cc43)c2C1(C)C |
| InChI | InChI=1S/C47H39N3O/c1-46(2)40-16-10-8-14-34(40)38-25-24-33-37(43(38)47(46,3)4)23-20-30-19-18-29(26-39(30)33)28-49-45(31-12-6-5-7-13-31)50-44(48)32-21-22-36-35-15-9-11-17-41(35)51-42(36)27-32/h5-27H,28H2,1-4H3,(H2,48,49,50) |
| InChIKey | UHPGFPJWMVTGGW-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|