C46H34N4O2S — CID 167129353
8-amino-N'-(N-benzyl-C-dibenzofuran-3-ylcarbonimidoyl)-7-[(4-phenylphenyl)methylsulfanyl]dibenzofuran-1-carboximidamide (PubChem CID 167129353) has the molecular formula C46H34N4O2S and a molecular weight of 706.87 g/mol. Its IUPAC name is 8-amino-N'-(N-benzyl-C-dibenzofuran-3-ylcarbonimidoyl)-7-[(4-phenylphenyl)methylsulfanyl]dibenzofuran-1-carboximidamide.
| Compound Name | 8-amino-N'-(N-benzyl-C-dibenzofuran-3-ylcarbonimidoyl)-7-[(4-phenylphenyl)methylsulfanyl]dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 167129353 |
| Molecular Formula | C46H34N4O2S |
| Molecular Weight | 706.87 g/mol |
| Exact Mass | 706.24 |
| IUPAC Name | 8-amino-N'-(N-benzyl-C-dibenzofuran-3-ylcarbonimidoyl)-7-[(4-phenylphenyl)methylsulfanyl]dibenzofuran-1-carboximidamide |
| SMILES | N/C(=N\C(=N\Cc1ccccc1)c1ccc2c(c1)oc1ccccc12)c1cccc2oc3cc(SCc4ccc(-c5ccccc5)cc4)c(N)cc3c12 |
| InChI | InChI=1S/C46H34N4O2S/c47-38-25-37-42(26-43(38)53-28-30-18-20-32(21-19-30)31-12-5-2-6-13-31)52-40-17-9-15-36(44(37)40)45(48)50-46(49-27-29-10-3-1-4-11-29)33-22-23-35-34-14-7-8-16-39(34)51-41(35)24-33/h1-26H,27-28,47H2,(H2,48,49,50) |
| InChIKey | OMPDSHTWOXXQJX-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.87 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|