C45H24B5N3O3 — CID 174062450
CID 174062450 (PubChem CID 174062450) has the molecular formula C45H24B5N3O3 and a molecular weight of 708.77 g/mol.
| Compound Name | CID 174062450 |
|---|---|
| PubChem CID | 174062450 |
| Molecular Formula | C45H24B5N3O3 |
| Molecular Weight | 708.77 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(C(/N=C(\N)c2ccc3c(c2)oc2ccccc23)=N\Cc2cccc3oc4ccc(-c5ccc6c(c5)oc5ccccc56)cc4c23)c([B])c1[B] |
| InChI | InChI=1S/C45H24B5N3O3/c46-39-38(40(47)42(49)43(50)41(39)48)45(53-44(51)24-13-16-29-27-8-2-4-10-32(27)56-36(29)20-24)52-21-25-6-5-11-34-37(25)30-18-22(14-17-33(30)54-34)23-12-15-28-26-7-1-3-9-31(26)55-35(28)19-23/h1-20H,21H2,(H2,51,52,53) |
| InChIKey | UDZFNDBCUQLBTP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|