C48H37N3O — CID 170125500
N'-[C-(3-methylcyclohexa-1,5-dien-1-yl)-N-[(8-naphthalen-2-yldibenzofuran-1-yl)methyl]carbonimidoyl]-4-naphthalen-1-ylbenzenecarboximidamide (PubChem CID 170125500) has the molecular formula C48H37N3O and a molecular weight of 671.84 g/mol. Its IUPAC name is N'-[C-(3-methylcyclohexa-1,5-dien-1-yl)-N-[(8-naphthalen-2-yldibenzofuran-1-yl)methyl]carbonimidoyl]-4-naphthalen-1-ylbenzenecarboximidamide.
| Compound Name | N'-[C-(3-methylcyclohexa-1,5-dien-1-yl)-N-[(8-naphthalen-2-yldibenzofuran-1-yl)methyl]carbonimidoyl]-4-naphthalen-1-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170125500 |
| Molecular Formula | C48H37N3O |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | N'-[C-(3-methylcyclohexa-1,5-dien-1-yl)-N-[(8-naphthalen-2-yldibenzofuran-1-yl)methyl]carbonimidoyl]-4-naphthalen-1-ylbenzenecarboximidamide |
| SMILES | CC1C=C(C(=N/Cc2cccc3oc4ccc(-c5ccc6ccccc6c5)cc4c23)/N=C(\N)c2ccc(-c3cccc4ccccc34)cc2)C=CC1 |
| InChI | InChI=1S/C48H37N3O/c1-31-9-6-14-39(27-31)48(51-47(49)35-22-20-34(21-23-35)42-17-7-13-33-11-4-5-16-41(33)42)50-30-40-15-8-18-45-46(40)43-29-38(25-26-44(43)52-45)37-24-19-32-10-2-3-12-36(32)28-37/h2-8,10-29,31H,9,30H2,1H3,(H2,49,50,51) |
| InChIKey | MNIZKYIYUUYTOW-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|