About CID 178110464
CID 178110464 (PubChem CID 178110464) has the molecular formula C57H26B5N3O4
and a molecular weight of 870.91 g/mol.
Molecular Properties
| Compound Name | CID 178110464 |
| PubChem CID | 178110464 |
| Molecular Formula | C57H26B5N3O4 |
| Molecular Weight | 870.91 g/mol |
| Exact Mass | 871.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3cccc4oc5ccc(-c6ccc7c(c6)oc6ccccc67)cc5c34)nc(-c3cccc4oc5ccc(-c6ccc7c(c6)oc6ccccc67)cc5c34)n2)c([B])c1[B] |
| InChI | InChI=1S/C57H26B5N3O4/c58-50-49(51(59)53(61)54(62)52(50)60)57-64-55(35-9-5-13-43-47(35)37-23-27(17-21-41(37)66-43)29-15-19-33-31-7-1-3-11-39(31)68-45(33)25-29)63-56(65-57)36-10-6-14-44-48(36)38-24-28(18-22-42(38)67-44)30-16-20-34-32-8-2-4-12-40(32)69-46(34)26-30/h1-26H |
| InChIKey | YOGFGBVRSBMJHP-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 91.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 870.91 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178110464 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178110464?
The IUPAC name of CID 178110464 (CID 178110464) is not available.
What is the SMILES notation for CID 178110464?
The canonical SMILES for CID 178110464 is [B]c1c([B])c([B])c(-c2nc(-c3cccc4oc5ccc(-c6ccc7c(c6)oc6ccccc67)cc5c34)nc(-c3cccc4oc5ccc(-c6ccc7c(c6)oc6ccccc67)cc5c34)n2)c([B])c1[B].
What is the InChIKey of CID 178110464?
The InChIKey is YOGFGBVRSBMJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H26B5N3O4/c58-50-49(51(59)53(61)54(62)52(50)60)57-64-55(35-9-5-13-43-47(35)37-23-27(17-21-41(37)66-43)29-15-19-33-31-7-1-3-11-39(31)68-45(33)25-29)63-56(65-57)36-10-6-14-44-48(36)38-24-28(18-22-42(38)67-44)30-16-20-34-32-8-2-4-12-40(32)69-46(34)26-30/h1-26H.
What are the key properties of CID 178110464?
CID 178110464 has a molecular weight of 870.91 g/mol, XLogP of 9.77, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178110464 is sourced from PubChem (CID 178110464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).